C23H26N4 — CID 58656074
3-[2-[4-(2-phenylethyl)piperazin-1-yl]ethyl]-1H-indole-5-carbonitrile (PubChem CID 58656074) has the molecular formula C23H26N4 and a molecular weight of 358.49 g/mol. Its IUPAC name is 3-[2-[4-(2-phenylethyl)piperazin-1-yl]ethyl]-1H-indole-5-carbonitrile.
| Compound Name | 3-[2-[4-(2-phenylethyl)piperazin-1-yl]ethyl]-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 58656074 |
| Molecular Formula | C23H26N4 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | 3-[2-[4-(2-phenylethyl)piperazin-1-yl]ethyl]-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]cc(CCN3CCN(CCc4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C23H26N4/c24-17-20-6-7-23-22(16-20)21(18-25-23)9-11-27-14-12-26(13-15-27)10-8-19-4-2-1-3-5-19/h1-7,16,18,25H,8-15H2 |
| InChIKey | PSRKCPVDXIPOAE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |