C26H25N3 — CID 67598982
3-(2-pyrrolidin-1-ylethyl)-5-[2-(4-pyrrol-1-ylphenyl)ethynyl]-1H-indole (PubChem CID 67598982) has the molecular formula C26H25N3 and a molecular weight of 379.51 g/mol. Its IUPAC name is 3-(2-pyrrolidin-1-ylethyl)-5-[2-(4-pyrrol-1-ylphenyl)ethynyl]-1H-indole.
| Compound Name | 3-(2-pyrrolidin-1-ylethyl)-5-[2-(4-pyrrol-1-ylphenyl)ethynyl]-1H-indole |
|---|---|
| PubChem CID | 67598982 |
| Molecular Formula | C26H25N3 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 3-(2-pyrrolidin-1-ylethyl)-5-[2-(4-pyrrol-1-ylphenyl)ethynyl]-1H-indole |
| SMILES | C(#Cc1ccc2[nH]cc(CCN3CCCC3)c2c1)c1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C26H25N3/c1-2-15-28(14-1)18-13-23-20-27-26-12-9-22(19-25(23)26)6-5-21-7-10-24(11-8-21)29-16-3-4-17-29/h3-4,7-12,16-17,19-20,27H,1-2,13-15,18H2 |
| InChIKey | UQXCHTCJYITPFB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 23.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|