C20H32N2OSi — CID 174163040
tert-butyl-dimethyl-[[3-(2-pyrrolidin-1-ylethyl)-1H-indol-5-yl]oxy]silane (PubChem CID 174163040) has the molecular formula C20H32N2OSi and a molecular weight of 344.58 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[3-(2-pyrrolidin-1-ylethyl)-1H-indol-5-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[3-(2-pyrrolidin-1-ylethyl)-1H-indol-5-yl]oxy]silane |
|---|---|
| PubChem CID | 174163040 |
| Molecular Formula | C20H32N2OSi |
| Molecular Weight | 344.58 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | tert-butyl-dimethyl-[[3-(2-pyrrolidin-1-ylethyl)-1H-indol-5-yl]oxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2[nH]cc(CCN3CCCC3)c2c1 |
| InChI | InChI=1S/C20H32N2OSi/c1-20(2,3)24(4,5)23-17-8-9-19-18(14-17)16(15-21-19)10-13-22-11-6-7-12-22/h8-9,14-15,21H,6-7,10-13H2,1-5H3 |
| InChIKey | FYCUNRPLUMVFCD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.58 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|