C27H34N2O4Si — CID 140861796
[3-(2-acetamidoethyl)-1H-indol-5-yl] (E)-3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]prop-2-enoate (PubChem CID 140861796) has the molecular formula C27H34N2O4Si and a molecular weight of 478.67 g/mol. Its IUPAC name is [3-(2-acetamidoethyl)-1H-indol-5-yl] (E)-3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]prop-2-enoate.
| Compound Name | [3-(2-acetamidoethyl)-1H-indol-5-yl] (E)-3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 140861796 |
| Molecular Formula | C27H34N2O4Si |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | [3-(2-acetamidoethyl)-1H-indol-5-yl] (E)-3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]prop-2-enoate |
| SMILES | CC(=O)NCCc1c[nH]c2ccc(OC(=O)/C=C/c3ccc(O[Si](C)(C)C(C)(C)C)cc3)cc12 |
| InChI | InChI=1S/C27H34N2O4Si/c1-19(30)28-16-15-21-18-29-25-13-12-23(17-24(21)25)32-26(31)14-9-20-7-10-22(11-8-20)33-34(5,6)27(2,3)4/h7-14,17-18,29H,15-16H2,1-6H3,(H,28,30)/b14-9+ |
| InChIKey | ZCUUKQAWINXMGG-NTEUORMPSA-N |
| XLogP | 5.85 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|