C22H26N4O5 — CID 23573376
[3-(2-acetamidoethyl)-1H-indol-5-yl] 3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoate (PubChem CID 23573376) has the molecular formula C22H26N4O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is [3-(2-acetamidoethyl)-1H-indol-5-yl] 3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoate.
| Compound Name | [3-(2-acetamidoethyl)-1H-indol-5-yl] 3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoate |
|---|---|
| PubChem CID | 23573376 |
| Molecular Formula | C22H26N4O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | [3-(2-acetamidoethyl)-1H-indol-5-yl] 3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoate |
| SMILES | CC(=O)NCCc1c[nH]c2ccc(OC(=O)C(C)(Cc3ccc(O)c(O)c3)NN)cc12 |
| InChI | InChI=1S/C22H26N4O5/c1-13(27)24-8-7-15-12-25-18-5-4-16(10-17(15)18)31-21(30)22(2,26-23)11-14-3-6-19(28)20(29)9-14/h3-6,9-10,12,25-26,28-29H,7-8,11,23H2,1-2H3,(H,24,27) |
| InChIKey | BJVWQEWIUHKXME-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 149.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|