C23H28N4O3 — CID 69014970
3-(2-aminoethyl)-1H-indol-5-ol;N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide (PubChem CID 69014970) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 3-(2-aminoethyl)-1H-indol-5-ol;N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide.
| Compound Name | 3-(2-aminoethyl)-1H-indol-5-ol;N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 69014970 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 3-(2-aminoethyl)-1H-indol-5-ol;N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide |
| SMILES | COc1ccc2[nH]cc(CCNC(C)=O)c2c1.NCCc1c[nH]c2ccc(O)cc12 |
| InChI | InChI=1S/C13H16N2O2.C10H12N2O/c1-9(16)14-6-5-10-8-15-13-4-3-11(17-2)7-12(10)13;11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h3-4,7-8,15H,5-6H2,1-2H3,(H,14,16);1-2,5-6,12-13H,3-4,11H2 |
| InChIKey | OCMHFRCTNLHPJK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 116.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |