C21H27N3O2 — CID 130246864
N-ethylaniline;N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide (PubChem CID 130246864) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is N-ethylaniline;N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide.
| Compound Name | N-ethylaniline;N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 130246864 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | N-ethylaniline;N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide |
| SMILES | CCNc1ccccc1.COc1ccc2[nH]cc(CCNC(C)=O)c2c1 |
| InChI | InChI=1S/C13H16N2O2.C8H11N/c1-9(16)14-6-5-10-8-15-13-4-3-11(17-2)7-12(10)13;1-2-9-8-6-4-3-5-7-8/h3-4,7-8,15H,5-6H2,1-2H3,(H,14,16);3-7,9H,2H2,1H3 |
| InChIKey | ZJRVNDFGAIQWHE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |