C33H46N2O4 — CID 87408458
icosa-2,4,6,8,10-pentaenoic acid;N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide (PubChem CID 87408458) has the molecular formula C33H46N2O4 and a molecular weight of 534.74 g/mol. Its IUPAC name is icosa-2,4,6,8,10-pentaenoic acid;N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide.
| Compound Name | icosa-2,4,6,8,10-pentaenoic acid;N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 87408458 |
| Molecular Formula | C33H46N2O4 |
| Molecular Weight | 534.74 g/mol |
| Exact Mass | 534.35 |
| IUPAC Name | icosa-2,4,6,8,10-pentaenoic acid;N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide |
| SMILES | CCCCCCCCCC=CC=CC=CC=CC=CC(=O)O.COc1ccc2[nH]cc(CCNC(C)=O)c2c1 |
| InChI | InChI=1S/C20H30O2.C13H16N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22;1-9(16)14-6-5-10-8-15-13-4-3-11(17-2)7-12(10)13/h10-19H,2-9H2,1H3,(H,21,22);3-4,7-8,15H,5-6H2,1-2H3,(H,14,16) |
| InChIKey | HQXGQAJLJZGBER-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.74 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|