C24H29N3O2 — CID 19438866
3-[2-[4-(3,4-dihydro-2H-chromen-6-yl)piperazin-1-yl]ethyl]-5-methoxy-1H-indole (PubChem CID 19438866) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 3-[2-[4-(3,4-dihydro-2H-chromen-6-yl)piperazin-1-yl]ethyl]-5-methoxy-1H-indole.
| Compound Name | 3-[2-[4-(3,4-dihydro-2H-chromen-6-yl)piperazin-1-yl]ethyl]-5-methoxy-1H-indole |
|---|---|
| PubChem CID | 19438866 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 3-[2-[4-(3,4-dihydro-2H-chromen-6-yl)piperazin-1-yl]ethyl]-5-methoxy-1H-indole |
| SMILES | COc1ccc2[nH]cc(CCN3CCN(c4ccc5c(c4)CCCO5)CC3)c2c1 |
| InChI | InChI=1S/C24H29N3O2/c1-28-21-5-6-23-22(16-21)19(17-25-23)8-9-26-10-12-27(13-11-26)20-4-7-24-18(15-20)3-2-14-29-24/h4-7,15-17,25H,2-3,8-14H2,1H3 |
| InChIKey | BVSOHPSQPZIGIG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 40.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|