C26H31N3O3 — CID 19438875
ethyl 3-[2-[4-(3,4-dihydro-2H-chromen-6-yl)piperazin-1-yl]ethyl]-1H-indole-5-carboxylate (PubChem CID 19438875) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is ethyl 3-[2-[4-(3,4-dihydro-2H-chromen-6-yl)piperazin-1-yl]ethyl]-1H-indole-5-carboxylate.
| Compound Name | ethyl 3-[2-[4-(3,4-dihydro-2H-chromen-6-yl)piperazin-1-yl]ethyl]-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 19438875 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | ethyl 3-[2-[4-(3,4-dihydro-2H-chromen-6-yl)piperazin-1-yl]ethyl]-1H-indole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2[nH]cc(CCN3CCN(c4ccc5c(c4)CCCO5)CC3)c2c1 |
| InChI | InChI=1S/C26H31N3O3/c1-2-31-26(30)20-5-7-24-23(17-20)21(18-27-24)9-10-28-11-13-29(14-12-28)22-6-8-25-19(16-22)4-3-15-32-25/h5-8,16-18,27H,2-4,9-15H2,1H3 |
| InChIKey | LFTLXTMCSPONRY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|