C24H29N3O2 — CID 19936446
methyl 3-[4-(4-phenylpiperazin-1-yl)butyl]-1H-indole-5-carboxylate (PubChem CID 19936446) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is methyl 3-[4-(4-phenylpiperazin-1-yl)butyl]-1H-indole-5-carboxylate.
| Compound Name | methyl 3-[4-(4-phenylpiperazin-1-yl)butyl]-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 19936446 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | methyl 3-[4-(4-phenylpiperazin-1-yl)butyl]-1H-indole-5-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]cc(CCCCN3CCN(c4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C24H29N3O2/c1-29-24(28)19-10-11-23-22(17-19)20(18-25-23)7-5-6-12-26-13-15-27(16-14-26)21-8-3-2-4-9-21/h2-4,8-11,17-18,25H,5-7,12-16H2,1H3 |
| InChIKey | GTCRIIOPGCGQMP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|