C27H28FN3O4 — CID 21190447
methyl 3-[4-[4-(7-fluoro-2-oxochromen-4-yl)piperazin-1-yl]butyl]-1H-indole-5-carboxylate (PubChem CID 21190447) has the molecular formula C27H28FN3O4 and a molecular weight of 477.54 g/mol. Its IUPAC name is methyl 3-[4-[4-(7-fluoro-2-oxochromen-4-yl)piperazin-1-yl]butyl]-1H-indole-5-carboxylate.
| Compound Name | methyl 3-[4-[4-(7-fluoro-2-oxochromen-4-yl)piperazin-1-yl]butyl]-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 21190447 |
| Molecular Formula | C27H28FN3O4 |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | methyl 3-[4-[4-(7-fluoro-2-oxochromen-4-yl)piperazin-1-yl]butyl]-1H-indole-5-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]cc(CCCCN3CCN(c4cc(=O)oc5cc(F)ccc45)CC3)c2c1 |
| InChI | InChI=1S/C27H28FN3O4/c1-34-27(33)18-5-8-23-22(14-18)19(17-29-23)4-2-3-9-30-10-12-31(13-11-30)24-16-26(32)35-25-15-20(28)6-7-21(24)25/h5-8,14-17,29H,2-4,9-13H2,1H3 |
| InChIKey | YNDICKIVJWNBSZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 78.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|