C20H26N2O3 — CID 174284025
methyl 3-[4-[3-(hydroxymethyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-1H-indole-5-carboxylate (PubChem CID 174284025) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is methyl 3-[4-[3-(hydroxymethyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-1H-indole-5-carboxylate.
| Compound Name | methyl 3-[4-[3-(hydroxymethyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 174284025 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | methyl 3-[4-[3-(hydroxymethyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-1H-indole-5-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]cc(CCCCN3CC=CC(CO)C3)c2c1 |
| InChI | InChI=1S/C20H26N2O3/c1-25-20(24)16-7-8-19-18(11-16)17(12-21-19)6-2-3-9-22-10-4-5-15(13-22)14-23/h4-5,7-8,11-12,15,21,23H,2-3,6,9-10,13-14H2,1H3 |
| InChIKey | WZAWGNBXRUCZGQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|