C25H30N2O2 — CID 70044868
3-[4-[3-(3,4-dimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-1H-indole (PubChem CID 70044868) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 3-[4-[3-(3,4-dimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-1H-indole.
| Compound Name | 3-[4-[3-(3,4-dimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-1H-indole |
|---|---|
| PubChem CID | 70044868 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 3-[4-[3-(3,4-dimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-1H-indole |
| SMILES | COc1ccc(C2C=CCN(CCCCc3c[nH]c4ccccc34)C2)cc1OC |
| InChI | InChI=1S/C25H30N2O2/c1-28-24-13-12-19(16-25(24)29-2)21-9-7-15-27(18-21)14-6-5-8-20-17-26-23-11-4-3-10-22(20)23/h3-4,7,9-13,16-17,21,26H,5-6,8,14-15,18H2,1-2H3 |
| InChIKey | DBHFWFVVRYPGIU-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 37.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|