C23H26N2O — CID 70044138
3-[4-(3-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indol-6-ol (PubChem CID 70044138) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is 3-[4-(3-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indol-6-ol.
| Compound Name | 3-[4-(3-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indol-6-ol |
|---|---|
| PubChem CID | 70044138 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 3-[4-(3-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indol-6-ol |
| SMILES | Oc1ccc2c(CCCCN3CC=CC(c4ccccc4)C3)c[nH]c2c1 |
| InChI | InChI=1S/C23H26N2O/c26-21-11-12-22-19(16-24-23(22)15-21)9-4-5-13-25-14-6-10-20(17-25)18-7-2-1-3-8-18/h1-3,6-8,10-12,15-16,20,24,26H,4-5,9,13-14,17H2 |
| InChIKey | PASBLNRBODGGQL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|