C24H28N2O3 — CID 19786740
3-[4-[3-(4-hydroxyphenyl)piperidin-1-yl]butyl]-1H-indole-5-carboxylic acid (PubChem CID 19786740) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 3-[4-[3-(4-hydroxyphenyl)piperidin-1-yl]butyl]-1H-indole-5-carboxylic acid.
| Compound Name | 3-[4-[3-(4-hydroxyphenyl)piperidin-1-yl]butyl]-1H-indole-5-carboxylic acid |
|---|---|
| PubChem CID | 19786740 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 3-[4-[3-(4-hydroxyphenyl)piperidin-1-yl]butyl]-1H-indole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2[nH]cc(CCCCN3CCCC(c4ccc(O)cc4)C3)c2c1 |
| InChI | InChI=1S/C24H28N2O3/c27-21-9-6-17(7-10-21)20-5-3-13-26(16-20)12-2-1-4-19-15-25-23-11-8-18(24(28)29)14-22(19)23/h6-11,14-15,20,25,27H,1-5,12-13,16H2,(H,28,29) |
| InChIKey | YIGUIXPHPSTMTR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|