C27H30N4O3 — CID 67713635
3-[4-[4-(1H-indole-5-carbonylamino)piperidin-1-yl]butyl]-1H-indole-5-carboxylic acid (PubChem CID 67713635) has the molecular formula C27H30N4O3 and a molecular weight of 458.56 g/mol. Its IUPAC name is 3-[4-[4-(1H-indole-5-carbonylamino)piperidin-1-yl]butyl]-1H-indole-5-carboxylic acid.
| Compound Name | 3-[4-[4-(1H-indole-5-carbonylamino)piperidin-1-yl]butyl]-1H-indole-5-carboxylic acid |
|---|---|
| PubChem CID | 67713635 |
| Molecular Formula | C27H30N4O3 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | 3-[4-[4-(1H-indole-5-carbonylamino)piperidin-1-yl]butyl]-1H-indole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2[nH]cc(CCCCN3CCC(NC(=O)c4ccc5[nH]ccc5c4)CC3)c2c1 |
| InChI | InChI=1S/C27H30N4O3/c32-26(19-4-6-24-18(15-19)8-11-28-24)30-22-9-13-31(14-10-22)12-2-1-3-21-17-29-25-7-5-20(27(33)34)16-23(21)25/h4-8,11,15-17,22,28-29H,1-3,9-10,12-14H2,(H,30,32)(H,33,34) |
| InChIKey | GYPAJDMBNKUEIF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|