C27H31N5O2 — CID 22364702
3-[4-[5-(piperidin-4-ylcarbamoyl)indol-1-yl]butyl]-1H-indole-5-carboxamide (PubChem CID 22364702) has the molecular formula C27H31N5O2 and a molecular weight of 457.58 g/mol. Its IUPAC name is 3-[4-[5-(piperidin-4-ylcarbamoyl)indol-1-yl]butyl]-1H-indole-5-carboxamide.
| Compound Name | 3-[4-[5-(piperidin-4-ylcarbamoyl)indol-1-yl]butyl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 22364702 |
| Molecular Formula | C27H31N5O2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 3-[4-[5-(piperidin-4-ylcarbamoyl)indol-1-yl]butyl]-1H-indole-5-carboxamide |
| SMILES | NC(=O)c1ccc2[nH]cc(CCCCn3ccc4cc(C(=O)NC5CCNCC5)ccc43)c2c1 |
| InChI | InChI=1S/C27H31N5O2/c28-26(33)19-4-6-24-23(16-19)21(17-30-24)3-1-2-13-32-14-10-18-15-20(5-7-25(18)32)27(34)31-22-8-11-29-12-9-22/h4-7,10,14-17,22,29-30H,1-3,8-9,11-13H2,(H2,28,33)(H,31,34) |
| InChIKey | GXTDUVZCUCHVSG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|