C27H29N5O2 — CID 21469442
3-[4-[4-(5-carbamoyl-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-1H-indole-5-carboxamide (PubChem CID 21469442) has the molecular formula C27H29N5O2 and a molecular weight of 455.56 g/mol. Its IUPAC name is 3-[4-[4-(5-carbamoyl-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-1H-indole-5-carboxamide.
| Compound Name | 3-[4-[4-(5-carbamoyl-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 21469442 |
| Molecular Formula | C27H29N5O2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 3-[4-[4-(5-carbamoyl-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-1H-indole-5-carboxamide |
| SMILES | NC(=O)c1ccc2[nH]cc(CCCCN3CC=C(c4c[nH]c5ccc(C(N)=O)cc45)CC3)c2c1 |
| InChI | InChI=1S/C27H29N5O2/c28-26(33)18-4-6-24-21(13-18)20(15-30-24)3-1-2-10-32-11-8-17(9-12-32)23-16-31-25-7-5-19(27(29)34)14-22(23)25/h4-8,13-16,30-31H,1-3,9-12H2,(H2,28,33)(H2,29,34) |
| InChIKey | XNWSLYSGYYDIJP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 121.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|