C33H35N3O4 — CID 70364316
2-[[3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indol-5-yl]oxycarbonylamino]ethyl benzoate (PubChem CID 70364316) has the molecular formula C33H35N3O4 and a molecular weight of 537.66 g/mol. Its IUPAC name is 2-[[3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indol-5-yl]oxycarbonylamino]ethyl benzoate.
| Compound Name | 2-[[3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indol-5-yl]oxycarbonylamino]ethyl benzoate |
|---|---|
| PubChem CID | 70364316 |
| Molecular Formula | C33H35N3O4 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | 2-[[3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indol-5-yl]oxycarbonylamino]ethyl benzoate |
| SMILES | O=C(NCCOC(=O)c1ccccc1)Oc1ccc2[nH]cc(CCCCN3CC=C(c4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C33H35N3O4/c37-32(27-11-5-2-6-12-27)39-22-18-34-33(38)40-29-14-15-31-30(23-29)28(24-35-31)13-7-8-19-36-20-16-26(17-21-36)25-9-3-1-4-10-25/h1-6,9-12,14-16,23-24,35H,7-8,13,17-22H2,(H,34,38) |
| InChIKey | XMPYTEDAEBEXOQ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|