C26H29ClN2O2 — CID 67883037
ethyl 7-chloro-3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-4-carboxylate (PubChem CID 67883037) has the molecular formula C26H29ClN2O2 and a molecular weight of 436.98 g/mol. Its IUPAC name is ethyl 7-chloro-3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-4-carboxylate.
| Compound Name | ethyl 7-chloro-3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-4-carboxylate |
|---|---|
| PubChem CID | 67883037 |
| Molecular Formula | C26H29ClN2O2 |
| Molecular Weight | 436.98 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | ethyl 7-chloro-3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole-4-carboxylate |
| SMILES | CCOC(=O)c1ccc(Cl)c2[nH]cc(CCCCN3CC=C(c4ccccc4)CC3)c12 |
| InChI | InChI=1S/C26H29ClN2O2/c1-2-31-26(30)22-11-12-23(27)25-24(22)21(18-28-25)10-6-7-15-29-16-13-20(14-17-29)19-8-4-3-5-9-19/h3-5,8-9,11-13,18,28H,2,6-7,10,14-17H2,1H3 |
| InChIKey | ZYMRYEOSVWCASS-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.98 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|