C23H25ClN2 — CID 70483148
6-chloro-4-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole (PubChem CID 70483148) has the molecular formula C23H25ClN2 and a molecular weight of 364.92 g/mol. Its IUPAC name is 6-chloro-4-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole.
| Compound Name | 6-chloro-4-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole |
|---|---|
| PubChem CID | 70483148 |
| Molecular Formula | C23H25ClN2 |
| Molecular Weight | 364.92 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 6-chloro-4-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole |
| SMILES | Clc1cc(CCCCN2CC=C(c3ccccc3)CC2)c2cc[nH]c2c1 |
| InChI | InChI=1S/C23H25ClN2/c24-21-16-20(22-9-12-25-23(22)17-21)8-4-5-13-26-14-10-19(11-15-26)18-6-2-1-3-7-18/h1-3,6-7,9-10,12,16-17,25H,4-5,8,11,13-15H2 |
| InChIKey | MQPPMQHGZZOQIG-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.92 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|