C23H26ClFN2 — CID 10475148
5-fluoro-3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole;hydrochloride (PubChem CID 10475148) has the molecular formula C23H26ClFN2 and a molecular weight of 384.93 g/mol. Its IUPAC name is 5-fluoro-3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole;hydrochloride.
| Compound Name | 5-fluoro-3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole;hydrochloride |
|---|---|
| PubChem CID | 10475148 |
| Molecular Formula | C23H26ClFN2 |
| Molecular Weight | 384.93 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 5-fluoro-3-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-1H-indole;hydrochloride |
| SMILES | Cl.Fc1ccc2[nH]cc(CCCCN3CC=C(c4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C23H25FN2.ClH/c24-21-9-10-23-22(16-21)20(17-25-23)8-4-5-13-26-14-11-19(12-15-26)18-6-2-1-3-7-18;/h1-3,6-7,9-11,16-17,25H,4-5,8,12-15H2;1H |
| InChIKey | ZARUMLLIKYBLHO-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.93 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|