C24H29FN2 — CID 10133399
3-[4-[(3S)-3-benzylpiperidin-1-yl]butyl]-5-fluoro-1H-indole (PubChem CID 10133399) has the molecular formula C24H29FN2 and a molecular weight of 364.51 g/mol. Its IUPAC name is 3-[4-[(3S)-3-benzylpiperidin-1-yl]butyl]-5-fluoro-1H-indole.
| Compound Name | 3-[4-[(3S)-3-benzylpiperidin-1-yl]butyl]-5-fluoro-1H-indole |
|---|---|
| PubChem CID | 10133399 |
| Molecular Formula | C24H29FN2 |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 3-[4-[(3S)-3-benzylpiperidin-1-yl]butyl]-5-fluoro-1H-indole |
| SMILES | Fc1ccc2[nH]cc(CCCCN3CCC[C@@H](Cc4ccccc4)C3)c2c1 |
| InChI | InChI=1S/C24H29FN2/c25-22-11-12-24-23(16-22)21(17-26-24)10-4-5-13-27-14-6-9-20(18-27)15-19-7-2-1-3-8-19/h1-3,7-8,11-12,16-17,20,26H,4-6,9-10,13-15,18H2/t20-/m0/s1 |
| InChIKey | CPIJNSLMQSHCKY-FQEVSTJZSA-N |
| XLogP | 5.58 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|