C24H27ClN2O — CID 18330255
1-(3-benzylpiperidin-1-yl)-4-(5-chloro-1H-indol-3-yl)butan-1-one (PubChem CID 18330255) has the molecular formula C24H27ClN2O and a molecular weight of 394.95 g/mol. Its IUPAC name is 1-(3-benzylpiperidin-1-yl)-4-(5-chloro-1H-indol-3-yl)butan-1-one.
| Compound Name | 1-(3-benzylpiperidin-1-yl)-4-(5-chloro-1H-indol-3-yl)butan-1-one |
|---|---|
| PubChem CID | 18330255 |
| Molecular Formula | C24H27ClN2O |
| Molecular Weight | 394.95 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 1-(3-benzylpiperidin-1-yl)-4-(5-chloro-1H-indol-3-yl)butan-1-one |
| SMILES | O=C(CCCc1c[nH]c2ccc(Cl)cc12)N1CCCC(Cc2ccccc2)C1 |
| InChI | InChI=1S/C24H27ClN2O/c25-21-11-12-23-22(15-21)20(16-26-23)9-4-10-24(28)27-13-5-8-19(17-27)14-18-6-2-1-3-7-18/h1-3,6-7,11-12,15-16,19,26H,4-5,8-10,13-14,17H2 |
| InChIKey | WVWKARDJFKCPTP-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.95 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |