C23H26ClN3O — CID 19323530
1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-4-(1H-indol-3-yl)butan-1-one (PubChem CID 19323530) has the molecular formula C23H26ClN3O and a molecular weight of 395.93 g/mol. Its IUPAC name is 1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-4-(1H-indol-3-yl)butan-1-one.
| Compound Name | 1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-4-(1H-indol-3-yl)butan-1-one |
|---|---|
| PubChem CID | 19323530 |
| Molecular Formula | C23H26ClN3O |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-4-(1H-indol-3-yl)butan-1-one |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)N1CCN(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C23H26ClN3O/c24-20-7-3-5-18(15-20)17-26-11-13-27(14-12-26)23(28)10-4-6-19-16-25-22-9-2-1-8-21(19)22/h1-3,5,7-9,15-16,25H,4,6,10-14,17H2 |
| InChIKey | LKCXYONAAMYNPF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |