C19H18ClNO2 — CID 7541533
(3-chlorophenyl)methyl 4-(1H-indol-3-yl)butanoate (PubChem CID 7541533) has the molecular formula C19H18ClNO2 and a molecular weight of 327.81 g/mol. Its IUPAC name is (3-chlorophenyl)methyl 4-(1H-indol-3-yl)butanoate.
| Compound Name | (3-chlorophenyl)methyl 4-(1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 7541533 |
| Molecular Formula | C19H18ClNO2 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | (3-chlorophenyl)methyl 4-(1H-indol-3-yl)butanoate |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H18ClNO2/c20-16-7-3-5-14(11-16)13-23-19(22)10-4-6-15-12-21-18-9-2-1-8-17(15)18/h1-3,5,7-9,11-12,21H,4,6,10,13H2 |
| InChIKey | FXQBNAHRZAVTAU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |