C20H20ClNS2 — CID 58171229
2-(3-chlorophenyl)ethyl 4-(1H-indol-3-yl)butanedithioate (PubChem CID 58171229) has the molecular formula C20H20ClNS2 and a molecular weight of 373.97 g/mol. Its IUPAC name is 2-(3-chlorophenyl)ethyl 4-(1H-indol-3-yl)butanedithioate.
| Compound Name | 2-(3-chlorophenyl)ethyl 4-(1H-indol-3-yl)butanedithioate |
|---|---|
| PubChem CID | 58171229 |
| Molecular Formula | C20H20ClNS2 |
| Molecular Weight | 373.97 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 2-(3-chlorophenyl)ethyl 4-(1H-indol-3-yl)butanedithioate |
| SMILES | S=C(CCCc1c[nH]c2ccccc12)SCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H20ClNS2/c21-17-7-3-5-15(13-17)11-12-24-20(23)10-4-6-16-14-22-19-9-2-1-8-18(16)19/h1-3,5,7-9,13-14,22H,4,6,10-12H2 |
| InChIKey | SAJGRYXLVZGEIZ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.97 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|