C21H23NOS2 — CID 58171051
2-(3-methoxyphenyl)ethyl 4-(1H-indol-3-yl)butanedithioate (PubChem CID 58171051) has the molecular formula C21H23NOS2 and a molecular weight of 369.56 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)ethyl 4-(1H-indol-3-yl)butanedithioate.
| Compound Name | 2-(3-methoxyphenyl)ethyl 4-(1H-indol-3-yl)butanedithioate |
|---|---|
| PubChem CID | 58171051 |
| Molecular Formula | C21H23NOS2 |
| Molecular Weight | 369.56 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-(3-methoxyphenyl)ethyl 4-(1H-indol-3-yl)butanedithioate |
| SMILES | COc1cccc(CCSC(=S)CCCc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C21H23NOS2/c1-23-18-8-4-6-16(14-18)12-13-25-21(24)11-5-7-17-15-22-20-10-3-2-9-19(17)20/h2-4,6,8-10,14-15,22H,5,7,11-13H2,1H3 |
| InChIKey | KKOXELAODYARSH-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.56 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|