C17H17NO — CID 22038177
3-[2-(3-methoxyphenyl)ethyl]-1H-indole (PubChem CID 22038177) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-[2-(3-methoxyphenyl)ethyl]-1H-indole.
| Compound Name | 3-[2-(3-methoxyphenyl)ethyl]-1H-indole |
|---|---|
| PubChem CID | 22038177 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 3-[2-(3-methoxyphenyl)ethyl]-1H-indole |
| SMILES | COc1cccc(CCc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C17H17NO/c1-19-15-6-4-5-13(11-15)9-10-14-12-18-17-8-3-2-7-16(14)17/h2-8,11-12,18H,9-10H2,1H3 |
| InChIKey | QWXDFIQPPURIAK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |