C19H23N2O2+ — CID 2055772
(3,5-dimethoxyphenyl)methyl-[2-(1H-indol-3-yl)ethyl]azanium (PubChem CID 2055772) has the molecular formula C19H23N2O2+ and a molecular weight of 311.41 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)methyl-[2-(1H-indol-3-yl)ethyl]azanium.
| Compound Name | (3,5-dimethoxyphenyl)methyl-[2-(1H-indol-3-yl)ethyl]azanium |
|---|---|
| PubChem CID | 2055772 |
| Molecular Formula | C19H23N2O2+ |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | (3,5-dimethoxyphenyl)methyl-[2-(1H-indol-3-yl)ethyl]azanium |
| SMILES | COc1cc(C[NH2+]CCc2c[nH]c3ccccc23)cc(OC)c1 |
| InChI | InChI=1S/C19H22N2O2/c1-22-16-9-14(10-17(11-16)23-2)12-20-8-7-15-13-21-19-6-4-3-5-18(15)19/h3-6,9-11,13,20-21H,7-8,12H2,1-2H3/p+1 |
| InChIKey | GZNLWQYOQRHZNH-UHFFFAOYSA-O |
| XLogP | 2.49 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|