C21H25N2O2+ — CID 7248572
2-(1H-indol-3-yl)ethyl-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]azanium (PubChem CID 7248572) has the molecular formula C21H25N2O2+ and a molecular weight of 337.44 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)ethyl-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]azanium.
| Compound Name | 2-(1H-indol-3-yl)ethyl-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 7248572 |
| Molecular Formula | C21H25N2O2+ |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 2-(1H-indol-3-yl)ethyl-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]azanium |
| SMILES | C=CCOc1ccc(C[NH2+]CCc2c[nH]c3ccccc23)cc1OC |
| InChI | InChI=1S/C21H24N2O2/c1-3-12-25-20-9-8-16(13-21(20)24-2)14-22-11-10-17-15-23-19-7-5-4-6-18(17)19/h3-9,13,15,22-23H,1,10-12,14H2,2H3/p+1 |
| InChIKey | JFONKZGXQXKZSN-UHFFFAOYSA-O |
| XLogP | 3.05 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|