C19H24NO2+ — CID 7951691
benzyl-[(3-ethoxy-4-prop-2-enoxyphenyl)methyl]azanium (PubChem CID 7951691) has the molecular formula C19H24NO2+ and a molecular weight of 298.41 g/mol. Its IUPAC name is benzyl-[(3-ethoxy-4-prop-2-enoxyphenyl)methyl]azanium.
| Compound Name | benzyl-[(3-ethoxy-4-prop-2-enoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 7951691 |
| Molecular Formula | C19H24NO2+ |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | benzyl-[(3-ethoxy-4-prop-2-enoxyphenyl)methyl]azanium |
| SMILES | C=CCOc1ccc(C[NH2+]Cc2ccccc2)cc1OCC |
| InChI | InChI=1S/C19H23NO2/c1-3-12-22-18-11-10-17(13-19(18)21-4-2)15-20-14-16-8-6-5-7-9-16/h3,5-11,13,20H,1,4,12,14-15H2,2H3/p+1 |
| InChIKey | BPEMSOJTVPITJU-UHFFFAOYSA-O |
| XLogP | 2.91 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|