C22H25N2O2+ — CID 7228103
(3-ethoxy-4-phenylmethoxyphenyl)methyl-(pyridin-3-ylmethyl)azanium (PubChem CID 7228103) has the molecular formula C22H25N2O2+ and a molecular weight of 349.45 g/mol. Its IUPAC name is (3-ethoxy-4-phenylmethoxyphenyl)methyl-(pyridin-3-ylmethyl)azanium.
| Compound Name | (3-ethoxy-4-phenylmethoxyphenyl)methyl-(pyridin-3-ylmethyl)azanium |
|---|---|
| PubChem CID | 7228103 |
| Molecular Formula | C22H25N2O2+ |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | (3-ethoxy-4-phenylmethoxyphenyl)methyl-(pyridin-3-ylmethyl)azanium |
| SMILES | CCOc1cc(C[NH2+]Cc2cccnc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C22H24N2O2/c1-2-25-22-13-19(14-24-16-20-9-6-12-23-15-20)10-11-21(22)26-17-18-7-4-3-5-8-18/h3-13,15,24H,2,14,16-17H2,1H3/p+1 |
| InChIKey | AJMWBZUYOWVWOF-UHFFFAOYSA-O |
| XLogP | 3.32 |
| TPSA | 47.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |