C24H28NO3+ — CID 8635968
(3-ethoxy-4-phenylmethoxyphenyl)methyl-[(4-methoxyphenyl)methyl]azanium (PubChem CID 8635968) has the molecular formula C24H28NO3+ and a molecular weight of 378.49 g/mol. Its IUPAC name is (3-ethoxy-4-phenylmethoxyphenyl)methyl-[(4-methoxyphenyl)methyl]azanium.
| Compound Name | (3-ethoxy-4-phenylmethoxyphenyl)methyl-[(4-methoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 8635968 |
| Molecular Formula | C24H28NO3+ |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | (3-ethoxy-4-phenylmethoxyphenyl)methyl-[(4-methoxyphenyl)methyl]azanium |
| SMILES | CCOc1cc(C[NH2+]Cc2ccc(OC)cc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H27NO3/c1-3-27-24-15-21(17-25-16-19-9-12-22(26-2)13-10-19)11-14-23(24)28-18-20-7-5-4-6-8-20/h4-15,25H,3,16-18H2,1-2H3/p+1 |
| InChIKey | WESADXHODUGSOQ-UHFFFAOYSA-O |
| XLogP | 3.94 |
| TPSA | 44.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |