C20H26NO3+ — CID 7380519
(3-ethoxy-4-prop-2-enoxyphenyl)methyl-[(4-methoxyphenyl)methyl]azanium (PubChem CID 7380519) has the molecular formula C20H26NO3+ and a molecular weight of 328.43 g/mol. Its IUPAC name is (3-ethoxy-4-prop-2-enoxyphenyl)methyl-[(4-methoxyphenyl)methyl]azanium.
| Compound Name | (3-ethoxy-4-prop-2-enoxyphenyl)methyl-[(4-methoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 7380519 |
| Molecular Formula | C20H26NO3+ |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (3-ethoxy-4-prop-2-enoxyphenyl)methyl-[(4-methoxyphenyl)methyl]azanium |
| SMILES | C=CCOc1ccc(C[NH2+]Cc2ccc(OC)cc2)cc1OCC |
| InChI | InChI=1S/C20H25NO3/c1-4-12-24-19-11-8-17(13-20(19)23-5-2)15-21-14-16-6-9-18(22-3)10-7-16/h4,6-11,13,21H,1,5,12,14-15H2,2-3H3/p+1 |
| InChIKey | FMJSQBLPTSRWCE-UHFFFAOYSA-O |
| XLogP | 2.92 |
| TPSA | 44.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|