C25H26O4 — CID 54397178
1,2-bis[(4-methoxyphenyl)methoxy]-4-prop-2-enylbenzene (PubChem CID 54397178) has the molecular formula C25H26O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is 1,2-bis[(4-methoxyphenyl)methoxy]-4-prop-2-enylbenzene.
| Compound Name | 1,2-bis[(4-methoxyphenyl)methoxy]-4-prop-2-enylbenzene |
|---|---|
| PubChem CID | 54397178 |
| Molecular Formula | C25H26O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 1,2-bis[(4-methoxyphenyl)methoxy]-4-prop-2-enylbenzene |
| SMILES | C=CCc1ccc(OCc2ccc(OC)cc2)c(OCc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C25H26O4/c1-4-5-19-10-15-24(28-17-20-6-11-22(26-2)12-7-20)25(16-19)29-18-21-8-13-23(27-3)14-9-21/h4,6-16H,1,5,17-18H2,2-3H3 |
| InChIKey | VKUZAFXHDXDWCH-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|