C15H22O2 — CID 3024287
2-methoxy-1-pentoxy-4-prop-2-enylbenzene (PubChem CID 3024287) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-methoxy-1-pentoxy-4-prop-2-enylbenzene.
| Compound Name | 2-methoxy-1-pentoxy-4-prop-2-enylbenzene |
|---|---|
| PubChem CID | 3024287 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 2-methoxy-1-pentoxy-4-prop-2-enylbenzene |
| SMILES | C=CCc1ccc(OCCCCC)c(OC)c1 |
| InChI | InChI=1S/C15H22O2/c1-4-6-7-11-17-14-10-9-13(8-5-2)12-15(14)16-3/h5,9-10,12H,2,4,6-8,11H2,1,3H3 |
| InChIKey | JEQOQDNQQSEKIA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|