C14H20O2 — CID 3019586
1-butoxy-2-methoxy-4-prop-2-enylbenzene (PubChem CID 3019586) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 1-butoxy-2-methoxy-4-prop-2-enylbenzene.
| Compound Name | 1-butoxy-2-methoxy-4-prop-2-enylbenzene |
|---|---|
| PubChem CID | 3019586 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 1-butoxy-2-methoxy-4-prop-2-enylbenzene |
| SMILES | C=CCc1ccc(OCCCC)c(OC)c1 |
| InChI | InChI=1S/C14H20O2/c1-4-6-10-16-13-9-8-12(7-5-2)11-14(13)15-3/h5,8-9,11H,2,4,6-7,10H2,1,3H3 |
| InChIKey | UHKLUPWESCIICB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|