C13H19KO2 — CID 175484509
potassium;hydride;2-methoxy-4-prop-2-enyl-1-propoxybenzene (PubChem CID 175484509) has the molecular formula C13H19KO2 and a molecular weight of 246.39 g/mol. Its IUPAC name is potassium;hydride;2-methoxy-4-prop-2-enyl-1-propoxybenzene.
| Compound Name | potassium;hydride;2-methoxy-4-prop-2-enyl-1-propoxybenzene |
|---|---|
| PubChem CID | 175484509 |
| Molecular Formula | C13H19KO2 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | potassium;hydride;2-methoxy-4-prop-2-enyl-1-propoxybenzene |
| SMILES | C=CCc1ccc(OCCC)c(OC)c1.[H-].[K+] |
| InChI | InChI=1S/C13H18O2.K.H/c1-4-6-11-7-8-12(15-9-5-2)13(10-11)14-3;;/h4,7-8,10H,1,5-6,9H2,2-3H3;;/q;+1;-1 |
| InChIKey | OCQOUFHLNUAWNE-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|