C23H28O4 — CID 160676628
2-methoxy-1-prop-2-enoxy-4-prop-2-enylbenzene;2-methoxy-4-prop-2-enylphenol (PubChem CID 160676628) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is 2-methoxy-1-prop-2-enoxy-4-prop-2-enylbenzene;2-methoxy-4-prop-2-enylphenol.
| Compound Name | 2-methoxy-1-prop-2-enoxy-4-prop-2-enylbenzene;2-methoxy-4-prop-2-enylphenol |
|---|---|
| PubChem CID | 160676628 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 2-methoxy-1-prop-2-enoxy-4-prop-2-enylbenzene;2-methoxy-4-prop-2-enylphenol |
| SMILES | C=CCOc1ccc(CC=C)cc1OC.C=CCc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C13H16O2.C10H12O2/c1-4-6-11-7-8-12(15-9-5-2)13(10-11)14-3;1-3-4-8-5-6-9(11)10(7-8)12-2/h4-5,7-8,10H,1-2,6,9H2,3H3;3,5-7,11H,1,4H2,2H3 |
| InChIKey | RNPOHTTTYLGCGE-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|