C19H22O2 — CID 78421503
2-methoxy-4-prop-2-enylphenol;prop-1-enylbenzene (PubChem CID 78421503) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is 2-methoxy-4-prop-2-enylphenol;prop-1-enylbenzene.
| Compound Name | 2-methoxy-4-prop-2-enylphenol;prop-1-enylbenzene |
|---|---|
| PubChem CID | 78421503 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 2-methoxy-4-prop-2-enylphenol;prop-1-enylbenzene |
| SMILES | C=CCc1ccc(O)c(OC)c1.CC=Cc1ccccc1 |
| InChI | InChI=1S/C10H12O2.C9H10/c1-3-4-8-5-6-9(11)10(7-8)12-2;1-2-6-9-7-4-3-5-8-9/h3,5-7,11H,1,4H2,2H3;2-8H,1H3 |
| InChIKey | JKTRXPUEIZZFGE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|