C10H12NaO2 — CID 69284850
CID 69284850 (PubChem CID 69284850) has the molecular formula C10H12NaO2 and a molecular weight of 187.19 g/mol.
| Compound Name | CID 69284850 |
|---|---|
| PubChem CID | 69284850 |
| Molecular Formula | C10H12NaO2 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | — |
| SMILES | C=CCc1ccc(O)c(OC)c1.[Na] |
| InChI | InChI=1S/C10H12O2.Na/c1-3-4-8-5-6-9(11)10(7-8)12-2;/h3,5-7,11H,1,4H2,2H3; |
| InChIKey | YXAQTUMTSYQJHN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|