C20H30O3 — CID 67418648
2-methoxy-4-prop-2-enylphenol;2,6,6-trimethylbicyclo[3.1.1]heptan-3-ol (PubChem CID 67418648) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is 2-methoxy-4-prop-2-enylphenol;2,6,6-trimethylbicyclo[3.1.1]heptan-3-ol.
| Compound Name | 2-methoxy-4-prop-2-enylphenol;2,6,6-trimethylbicyclo[3.1.1]heptan-3-ol |
|---|---|
| PubChem CID | 67418648 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 2-methoxy-4-prop-2-enylphenol;2,6,6-trimethylbicyclo[3.1.1]heptan-3-ol |
| SMILES | C=CCc1ccc(O)c(OC)c1.CC1C(O)CC2CC1C2(C)C |
| InChI | InChI=1S/C10H12O2.C10H18O/c1-3-4-8-5-6-9(11)10(7-8)12-2;1-6-8-4-7(5-9(6)11)10(8,2)3/h3,5-7,11H,1,4H2,2H3;6-9,11H,4-5H2,1-3H3 |
| InChIKey | ZCDQGOKBYVZMSE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|