About ethoxybenzene;2-methoxy-4-prop-2-enylphenol
ethoxybenzene;2-methoxy-4-prop-2-enylphenol (PubChem CID 69392132) has the molecular formula C18H22O3
and a molecular weight of 286.37 g/mol. Its IUPAC name is ethoxybenzene;2-methoxy-4-prop-2-enylphenol.
Molecular Properties
| Compound Name | ethoxybenzene;2-methoxy-4-prop-2-enylphenol |
| PubChem CID | 69392132 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | ethoxybenzene;2-methoxy-4-prop-2-enylphenol |
| SMILES | C=CCc1ccc(O)c(OC)c1.CCOc1ccccc1 |
| InChI | InChI=1S/C10H12O2.C8H10O/c1-3-4-8-5-6-9(11)10(7-8)12-2;1-2-9-8-6-4-3-5-7-8/h3,5-7,11H,1,4H2,2H3;3-7H,2H2,1H3 |
| InChIKey | FFQCZJWGNXFGLE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethoxybenzene;2-methoxy-4-prop-2-enylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxybenzene;2-methoxy-4-prop-2-enylphenol?
The IUPAC name of ethoxybenzene;2-methoxy-4-prop-2-enylphenol (CID 69392132) is ethoxybenzene;2-methoxy-4-prop-2-enylphenol.
What is the SMILES notation for ethoxybenzene;2-methoxy-4-prop-2-enylphenol?
The canonical SMILES for ethoxybenzene;2-methoxy-4-prop-2-enylphenol is C=CCc1ccc(O)c(OC)c1.CCOc1ccccc1.
What is the InChIKey of ethoxybenzene;2-methoxy-4-prop-2-enylphenol?
The InChIKey is FFQCZJWGNXFGLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2.C8H10O/c1-3-4-8-5-6-9(11)10(7-8)12-2;1-2-9-8-6-4-3-5-7-8/h3,5-7,11H,1,4H2,2H3;3-7H,2H2,1H3.
What are the key properties of ethoxybenzene;2-methoxy-4-prop-2-enylphenol?
ethoxybenzene;2-methoxy-4-prop-2-enylphenol has a molecular weight of 286.37 g/mol, XLogP of 4.21, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxybenzene;2-methoxy-4-prop-2-enylphenol is sourced from PubChem (CID 69392132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).