About (2-methoxy-4-prop-2-enylphenyl) 2-phenoxyacetate
(2-methoxy-4-prop-2-enylphenyl) 2-phenoxyacetate (PubChem CID 137496757) has the molecular formula C18H18O4
and a molecular weight of 298.34 g/mol. Its IUPAC name is (2-methoxy-4-prop-2-enylphenyl) 2-phenoxyacetate.
Molecular Properties
| Compound Name | (2-methoxy-4-prop-2-enylphenyl) 2-phenoxyacetate |
| PubChem CID | 137496757 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (2-methoxy-4-prop-2-enylphenyl) 2-phenoxyacetate |
| SMILES | C=CCc1ccc(OC(=O)COc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C18H18O4/c1-3-7-14-10-11-16(17(12-14)20-2)22-18(19)13-21-15-8-5-4-6-9-15/h3-6,8-12H,1,7,13H2,2H3 |
| InChIKey | FMMRGSRQXDHAME-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-methoxy-4-prop-2-enylphenyl) 2-phenoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxy-4-prop-2-enylphenyl) 2-phenoxyacetate?
The IUPAC name of (2-methoxy-4-prop-2-enylphenyl) 2-phenoxyacetate (CID 137496757) is (2-methoxy-4-prop-2-enylphenyl) 2-phenoxyacetate.
What is the SMILES notation for (2-methoxy-4-prop-2-enylphenyl) 2-phenoxyacetate?
The canonical SMILES for (2-methoxy-4-prop-2-enylphenyl) 2-phenoxyacetate is C=CCc1ccc(OC(=O)COc2ccccc2)c(OC)c1.
What is the InChIKey of (2-methoxy-4-prop-2-enylphenyl) 2-phenoxyacetate?
The InChIKey is FMMRGSRQXDHAME-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O4/c1-3-7-14-10-11-16(17(12-14)20-2)22-18(19)13-21-15-8-5-4-6-9-15/h3-6,8-12H,1,7,13H2,2H3.
What are the key properties of (2-methoxy-4-prop-2-enylphenyl) 2-phenoxyacetate?
(2-methoxy-4-prop-2-enylphenyl) 2-phenoxyacetate has a molecular weight of 298.34 g/mol, XLogP of 3.41, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxy-4-prop-2-enylphenyl) 2-phenoxyacetate is sourced from PubChem (CID 137496757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).