About (4-cyano-2-methoxyphenyl) 2-phenoxyacetate
(4-cyano-2-methoxyphenyl) 2-phenoxyacetate (PubChem CID 2715586) has the molecular formula C16H13NO4
and a molecular weight of 283.28 g/mol. Its IUPAC name is (4-cyano-2-methoxyphenyl) 2-phenoxyacetate.
Molecular Properties
| Compound Name | (4-cyano-2-methoxyphenyl) 2-phenoxyacetate |
| PubChem CID | 2715586 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (4-cyano-2-methoxyphenyl) 2-phenoxyacetate |
| SMILES | COc1cc(C#N)ccc1OC(=O)COc1ccccc1 |
| InChI | InChI=1S/C16H13NO4/c1-19-15-9-12(10-17)7-8-14(15)21-16(18)11-20-13-5-3-2-4-6-13/h2-9H,11H2,1H3 |
| InChIKey | DXVAUMMKODYECC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-cyano-2-methoxyphenyl) 2-phenoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyano-2-methoxyphenyl) 2-phenoxyacetate?
The IUPAC name of (4-cyano-2-methoxyphenyl) 2-phenoxyacetate (CID 2715586) is (4-cyano-2-methoxyphenyl) 2-phenoxyacetate.
What is the SMILES notation for (4-cyano-2-methoxyphenyl) 2-phenoxyacetate?
The canonical SMILES for (4-cyano-2-methoxyphenyl) 2-phenoxyacetate is COc1cc(C#N)ccc1OC(=O)COc1ccccc1.
What is the InChIKey of (4-cyano-2-methoxyphenyl) 2-phenoxyacetate?
The InChIKey is DXVAUMMKODYECC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO4/c1-19-15-9-12(10-17)7-8-14(15)21-16(18)11-20-13-5-3-2-4-6-13/h2-9H,11H2,1H3.
What are the key properties of (4-cyano-2-methoxyphenyl) 2-phenoxyacetate?
(4-cyano-2-methoxyphenyl) 2-phenoxyacetate has a molecular weight of 283.28 g/mol, XLogP of 2.55, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyano-2-methoxyphenyl) 2-phenoxyacetate is sourced from PubChem (CID 2715586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).