C18H13N3O3S — CID 16560789
(4-cyano-2-methoxyphenyl) 2-(2-pyridin-2-yl-1,3-thiazol-4-yl)acetate (PubChem CID 16560789) has the molecular formula C18H13N3O3S and a molecular weight of 351.39 g/mol. Its IUPAC name is (4-cyano-2-methoxyphenyl) 2-(2-pyridin-2-yl-1,3-thiazol-4-yl)acetate.
| Compound Name | (4-cyano-2-methoxyphenyl) 2-(2-pyridin-2-yl-1,3-thiazol-4-yl)acetate |
|---|---|
| PubChem CID | 16560789 |
| Molecular Formula | C18H13N3O3S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | (4-cyano-2-methoxyphenyl) 2-(2-pyridin-2-yl-1,3-thiazol-4-yl)acetate |
| SMILES | COc1cc(C#N)ccc1OC(=O)Cc1csc(-c2ccccn2)n1 |
| InChI | InChI=1S/C18H13N3O3S/c1-23-16-8-12(10-19)5-6-15(16)24-17(22)9-13-11-25-18(21-13)14-4-2-3-7-20-14/h2-8,11H,9H2,1H3 |
| InChIKey | SQECCWQGZMVYMV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 85.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|