C17H11N3O2S — CID 42489484
(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl 4-cyanobenzoate (PubChem CID 42489484) has the molecular formula C17H11N3O2S and a molecular weight of 321.36 g/mol. Its IUPAC name is (2-pyridin-2-yl-1,3-thiazol-4-yl)methyl 4-cyanobenzoate.
| Compound Name | (2-pyridin-2-yl-1,3-thiazol-4-yl)methyl 4-cyanobenzoate |
|---|---|
| PubChem CID | 42489484 |
| Molecular Formula | C17H11N3O2S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | (2-pyridin-2-yl-1,3-thiazol-4-yl)methyl 4-cyanobenzoate |
| SMILES | N#Cc1ccc(C(=O)OCc2csc(-c3ccccn3)n2)cc1 |
| InChI | InChI=1S/C17H11N3O2S/c18-9-12-4-6-13(7-5-12)17(21)22-10-14-11-23-16(20-14)15-3-1-2-8-19-15/h1-8,11H,10H2 |
| InChIKey | DZKHHYSDTNBGBZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 75.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |