(2-phenyl-1,3-thiazol-4-yl)methyl pyridine-4-carboxylate

C16H12N2O2S — CID 7478095

IUPAC(2-phenyl-1,3-thiazol-4-yl)methyl pyridine-4-carboxylate
SMILESO=C(OCc1csc(-c2ccccc2)n1)c1ccncc1
InChIInChI=1S/C16H12N2O2S/c19-16(13-6-8-17-9-7-13)20-10-14-11-21-15(18-14)12-4-2-1-3-5-12/h1-9,11H,10H2
InChIKeyOJVQACKUIZHHKI-UHFFFAOYSA-N
MW296.35 g/mol
LogP3.56
Rot. Bonds4

About (2-phenyl-1,3-thiazol-4-yl)methyl pyridine-4-carboxylate

(2-phenyl-1,3-thiazol-4-yl)methyl pyridine-4-carboxylate (PubChem CID 7478095) has the molecular formula C16H12N2O2S and a molecular weight of 296.35 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl pyridine-4-carboxylate.

Molecular Properties

Compound Name(2-phenyl-1,3-thiazol-4-yl)methyl pyridine-4-carboxylate
PubChem CID7478095
Molecular FormulaC16H12N2O2S
Molecular Weight296.35 g/mol
Exact Mass296.06
IUPAC Name(2-phenyl-1,3-thiazol-4-yl)methyl pyridine-4-carboxylate
SMILESO=C(OCc1csc(-c2ccccc2)n1)c1ccncc1
InChIInChI=1S/C16H12N2O2S/c19-16(13-6-8-17-9-7-13)20-10-14-11-21-15(18-14)12-4-2-1-3-5-12/h1-9,11H,10H2
InChIKeyOJVQACKUIZHHKI-UHFFFAOYSA-N
XLogP3.56
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500296.35
LogP ≤ 53.56
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze (2-phenyl-1,3-thiazol-4-yl)methyl pyridine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-phenyl-1,3-thiazol-4-yl)methyl pyridine-4-carboxylate?
The IUPAC name of (2-phenyl-1,3-thiazol-4-yl)methyl pyridine-4-carboxylate (CID 7478095) is (2-phenyl-1,3-thiazol-4-yl)methyl pyridine-4-carboxylate.
What is the SMILES notation for (2-phenyl-1,3-thiazol-4-yl)methyl pyridine-4-carboxylate?
The canonical SMILES for (2-phenyl-1,3-thiazol-4-yl)methyl pyridine-4-carboxylate is O=C(OCc1csc(-c2ccccc2)n1)c1ccncc1.
What is the InChIKey of (2-phenyl-1,3-thiazol-4-yl)methyl pyridine-4-carboxylate?
The InChIKey is OJVQACKUIZHHKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O2S/c19-16(13-6-8-17-9-7-13)20-10-14-11-21-15(18-14)12-4-2-1-3-5-12/h1-9,11H,10H2.
What are the key properties of (2-phenyl-1,3-thiazol-4-yl)methyl pyridine-4-carboxylate?
(2-phenyl-1,3-thiazol-4-yl)methyl pyridine-4-carboxylate has a molecular weight of 296.35 g/mol, XLogP of 3.56, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenyl-1,3-thiazol-4-yl)methyl pyridine-4-carboxylate is sourced from PubChem (CID 7478095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).