C16H12N2O2S — CID 7478095
(2-phenyl-1,3-thiazol-4-yl)methyl pyridine-4-carboxylate (PubChem CID 7478095) has the molecular formula C16H12N2O2S and a molecular weight of 296.35 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl pyridine-4-carboxylate.
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methyl pyridine-4-carboxylate |
|---|---|
| PubChem CID | 7478095 |
| Molecular Formula | C16H12N2O2S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methyl pyridine-4-carboxylate |
| SMILES | O=C(OCc1csc(-c2ccccc2)n1)c1ccncc1 |
| InChI | InChI=1S/C16H12N2O2S/c19-16(13-6-8-17-9-7-13)20-10-14-11-21-15(18-14)12-4-2-1-3-5-12/h1-9,11H,10H2 |
| InChIKey | OJVQACKUIZHHKI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |